C13H26 — CID 90972647
2-butan-2-yl-1,3,5-trimethylcyclohexane (PubChem CID 90972647) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is 2-butan-2-yl-1,3,5-trimethylcyclohexane.
| Compound Name | 2-butan-2-yl-1,3,5-trimethylcyclohexane |
|---|---|
| PubChem CID | 90972647 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 2-butan-2-yl-1,3,5-trimethylcyclohexane |
| SMILES | CCC(C)C1C(C)CC(C)CC1C |
| InChI | InChI=1S/C13H26/c1-6-10(3)13-11(4)7-9(2)8-12(13)5/h9-13H,6-8H2,1-5H3 |
| InChIKey | WDDPMOAEZYRNSC-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |