About 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane
1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane (PubChem CID 91069892) has the molecular formula C13H26
and a molecular weight of 182.35 g/mol. Its IUPAC name is 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane.
Analyze 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane?
The IUPAC name of 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane (CID 91069892) is 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane.
What is the SMILES notation for 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane?
The canonical SMILES for 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane is CCC(C(C)C)C1CC(C)CC1C.
What is the InChIKey of 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane?
The InChIKey is BQIGMEYFVXAUDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26/c1-6-12(9(2)3)13-8-10(4)7-11(13)5/h9-13H,6-8H2,1-5H3.
What are the key properties of 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane?
1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane has a molecular weight of 182.35 g/mol, XLogP of 4.35, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dimethyl-2-(2-methylpentan-3-yl)cyclopentane is sourced from PubChem (CID 91069892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).