About 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane
1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane (PubChem CID 123429129) has the molecular formula C15H30
and a molecular weight of 210.40 g/mol. Its IUPAC name is 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane.
Analyze 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane?
The IUPAC name of 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane (CID 123429129) is 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane.
What is the SMILES notation for 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane?
The canonical SMILES for 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane is CCC(C)CC(C(C)C)C1CC(C)C1C.
What is the InChIKey of 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane?
The InChIKey is NGKDLEPHCQEYNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30/c1-7-11(4)8-14(10(2)3)15-9-12(5)13(15)6/h10-15H,7-9H2,1-6H3.
What are the key properties of 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane?
1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane has a molecular weight of 210.40 g/mol, XLogP of 4.99, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,5-dimethylheptan-3-yl)-2,3-dimethylcyclobutane is sourced from PubChem (CID 123429129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).