C9H17Cl — CID 131133771
1-(1-chloropropyl)-2,3-dimethylcyclobutane (PubChem CID 131133771) has the molecular formula C9H17Cl and a molecular weight of 160.69 g/mol. Its IUPAC name is 1-(1-chloropropyl)-2,3-dimethylcyclobutane.
| Compound Name | 1-(1-chloropropyl)-2,3-dimethylcyclobutane |
|---|---|
| PubChem CID | 131133771 |
| Molecular Formula | C9H17Cl |
| Molecular Weight | 160.69 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-(1-chloropropyl)-2,3-dimethylcyclobutane |
| SMILES | CCC(Cl)C1CC(C)C1C |
| InChI | InChI=1S/C9H17Cl/c1-4-9(10)8-5-6(2)7(8)3/h6-9H,4-5H2,1-3H3 |
| InChIKey | WQHMUDHPZWSCME-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.69 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|