C21H46 — CID 162022066
bis(3-methylhexane);1,2,3-trimethylcyclobutane (PubChem CID 162022066) has the molecular formula C21H46 and a molecular weight of 298.60 g/mol. Its IUPAC name is bis(3-methylhexane);1,2,3-trimethylcyclobutane.
| Compound Name | bis(3-methylhexane);1,2,3-trimethylcyclobutane |
|---|---|
| PubChem CID | 162022066 |
| Molecular Formula | C21H46 |
| Molecular Weight | 298.60 g/mol |
| Exact Mass | 298.36 |
| IUPAC Name | bis(3-methylhexane);1,2,3-trimethylcyclobutane |
| SMILES | CC1CC(C)C1C.CCCC(C)CC.CCCC(C)CC |
| InChI | InChI=1S/C7H14.2C7H16/c1-5-4-6(2)7(5)3;2*1-4-6-7(3)5-2/h5-7H,4H2,1-3H3;2*7H,4-6H2,1-3H3 |
| InChIKey | YUWJYNAOCARIOB-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.60 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |