C11H22 — CID 123945019
1,2-dimethyl-3-pentan-2-ylcyclobutane (PubChem CID 123945019) has the molecular formula C11H22 and a molecular weight of 154.30 g/mol. Its IUPAC name is 1,2-dimethyl-3-pentan-2-ylcyclobutane.
| Compound Name | 1,2-dimethyl-3-pentan-2-ylcyclobutane |
|---|---|
| PubChem CID | 123945019 |
| Molecular Formula | C11H22 |
| Molecular Weight | 154.30 g/mol |
| Exact Mass | 154.17 |
| IUPAC Name | 1,2-dimethyl-3-pentan-2-ylcyclobutane |
| SMILES | CCCC(C)C1CC(C)C1C |
| InChI | InChI=1S/C11H22/c1-5-6-8(2)11-7-9(3)10(11)4/h8-11H,5-7H2,1-4H3 |
| InChIKey | AOGWOKUYDNQXJX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |