C11H21Cl — CID 79307395
1-(1-chloropropyl)-2,3-dimethylcyclohexane (PubChem CID 79307395) has the molecular formula C11H21Cl and a molecular weight of 188.74 g/mol. Its IUPAC name is 1-(1-chloropropyl)-2,3-dimethylcyclohexane.
| Compound Name | 1-(1-chloropropyl)-2,3-dimethylcyclohexane |
|---|---|
| PubChem CID | 79307395 |
| Molecular Formula | C11H21Cl |
| Molecular Weight | 188.74 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 1-(1-chloropropyl)-2,3-dimethylcyclohexane |
| SMILES | CCC(Cl)C1CCCC(C)C1C |
| InChI | InChI=1S/C11H21Cl/c1-4-11(12)10-7-5-6-8(2)9(10)3/h8-11H,4-7H2,1-3H3 |
| InChIKey | BUDGFVLPJGSQOA-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.74 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|