About 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane
5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane (PubChem CID 143342016) has the molecular formula C28H60
and a molecular weight of 396.79 g/mol. Its IUPAC name is 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane.
Molecular Properties
| Compound Name | 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane |
| PubChem CID | 143342016 |
| Molecular Formula | C28H60 |
| Molecular Weight | 396.79 g/mol |
| Exact Mass | 396.47 |
| IUPAC Name | 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane |
| SMILES | CCC.CCC.CCCC1CC(C(CC(C)CC)C(C)C)CC(C(C)C)C1C |
| InChI | InChI=1S/C22H44.2C3H8/c1-9-11-19-13-20(14-21(15(3)4)18(19)8)22(16(5)6)12-17(7)10-2;2*1-3-2/h15-22H,9-14H2,1-8H3;2*3H2,1-2H3 |
| InChIKey | YWRULNQSJBLKHE-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.79 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane?
The IUPAC name of 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane (CID 143342016) is 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane.
What is the SMILES notation for 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane?
The canonical SMILES for 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane is CCC.CCC.CCCC1CC(C(CC(C)CC)C(C)C)CC(C(C)C)C1C.
What is the InChIKey of 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane?
The InChIKey is YWRULNQSJBLKHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44.2C3H8/c1-9-11-19-13-20(14-21(15(3)4)18(19)8)22(16(5)6)12-17(7)10-2;2*1-3-2/h15-22H,9-14H2,1-8H3;2*3H2,1-2H3.
What are the key properties of 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane?
5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane has a molecular weight of 396.79 g/mol, XLogP of 10.26, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,5-dimethylheptan-3-yl)-2-methyl-1-propan-2-yl-3-propylcyclohexane;propane is sourced from PubChem (CID 143342016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).