About 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane
1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane (PubChem CID 90869417) has the molecular formula C18H36
and a molecular weight of 252.49 g/mol. Its IUPAC name is 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane.
Analyze 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane?
The IUPAC name of 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane (CID 90869417) is 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane.
What is the SMILES notation for 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane?
The canonical SMILES for 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane is CCCCC(C)C(CC(C)CC)C1CC1C(C)C.
What is the InChIKey of 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane?
The InChIKey is SXDZPYQQFVSXRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36/c1-7-9-10-15(6)17(11-14(5)8-2)18-12-16(18)13(3)4/h13-18H,7-12H2,1-6H3.
What are the key properties of 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane?
1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane has a molecular weight of 252.49 g/mol, XLogP of 6.16, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,6-dimethyldecan-5-yl)-2-propan-2-ylcyclopropane is sourced from PubChem (CID 90869417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).