About 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane
1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane (PubChem CID 123453301) has the molecular formula C18H36
and a molecular weight of 252.49 g/mol. Its IUPAC name is 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane.
Analyze 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane?
The IUPAC name of 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane (CID 123453301) is 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane.
What is the SMILES notation for 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane?
The canonical SMILES for 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane is CCCCC(CC1CC1CC)C(C)CC(C)CC.
What is the InChIKey of 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane?
The InChIKey is BOLKRTXTRNUQLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36/c1-6-9-10-17(13-18-12-16(18)8-3)15(5)11-14(4)7-2/h14-18H,6-13H2,1-5H3.
What are the key properties of 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane?
1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane has a molecular weight of 252.49 g/mol, XLogP of 6.30, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-butyl-3,5-dimethylheptyl)-2-ethylcyclopropane is sourced from PubChem (CID 123453301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).