About trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane
trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane (PubChem CID 168764244) has the molecular formula C9H18
and a molecular weight of 126.24 g/mol. Its IUPAC name is trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane.
Analyze trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane?
The IUPAC name of trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane (CID 168764244) is trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane.
What is the SMILES notation for trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane?
The canonical SMILES for trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane is CC[C@@H]1C[C@H]1CC(C)C.
What is the InChIKey of trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane?
The InChIKey is FNUSCVRZQKZPLR-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H18/c1-4-8-6-9(8)5-7(2)3/h7-9H,4-6H2,1-3H3/t8-,9-/m1/s1.
What are the key properties of trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane?
trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane has a molecular weight of 126.24 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-1-ethyl-2-(2-methylpropyl)cyclopropane is sourced from PubChem (CID 168764244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).