C79H156 — CID 91210730
1-ethyl-2-[2-(2-ethylcyclopropyl)ethyl]cyclobutane;1,5,9,12,16,20,23,27,31-nonamethyl-3,7,14,18,25,29-hexakis(2-methylpropyl)cyclotritriacontane (PubChem CID 91210730) has the molecular formula C79H156 and a molecular weight of 1106.12 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-ethylcyclopropyl)ethyl]cyclobutane;1,5,9,12,16,20,23,27,31-nonamethyl-3,7,14,18,25,29-hexakis(2-methylpropyl)cyclotritriacontane.
| Compound Name | 1-ethyl-2-[2-(2-ethylcyclopropyl)ethyl]cyclobutane;1,5,9,12,16,20,23,27,31-nonamethyl-3,7,14,18,25,29-hexakis(2-methylpropyl)cyclotritriacontane |
|---|---|
| PubChem CID | 91210730 |
| Molecular Formula | C79H156 |
| Molecular Weight | 1106.12 g/mol |
| Exact Mass | 1105.22 |
| IUPAC Name | 1-ethyl-2-[2-(2-ethylcyclopropyl)ethyl]cyclobutane;1,5,9,12,16,20,23,27,31-nonamethyl-3,7,14,18,25,29-hexakis(2-methylpropyl)cyclotritriacontane |
| SMILES | CC(C)CC1CC(C)CCC(C)CC(CC(C)C)CC(C)CC(CC(C)C)CC(C)CCC(C)CC(CC(C)C)CC(C)CC(CC(C)C)CC(C)CCC(C)CC(CC(C)C)CC(C)C1.CCC1CCC1CCC1CC1CC |
| InChI | InChI=1S/C66H132.C13H24/c1-46(2)28-61-34-52(13)22-23-53(14)36-63(30-48(5)6)42-59(20)43-65(32-50(9)10)38-56(17)26-27-57(18)39-66(33-51(11)12)45-60(21)44-64(31-49(7)8)37-55(16)25-24-54(15)35-62(29-47(3)4)41-58(19)40-61;1-3-10-5-6-12(10)7-8-13-9-11(13)4-2/h46-66H,22-45H2,1-21H3;10-13H,3-9H2,1-2H3 |
| InChIKey | MXSIQPVPTCAWMR-UHFFFAOYSA-N |
| XLogP | 26.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 79 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1106.12 |
| LogP ≤ 5 | 26.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |