C17H38 — CID 91316763
1,4-dimethylcyclohexane;3-methylpentane;propane (PubChem CID 91316763) has the molecular formula C17H38 and a molecular weight of 242.49 g/mol. Its IUPAC name is 1,4-dimethylcyclohexane;3-methylpentane;propane.
| Compound Name | 1,4-dimethylcyclohexane;3-methylpentane;propane |
|---|---|
| PubChem CID | 91316763 |
| Molecular Formula | C17H38 |
| Molecular Weight | 242.49 g/mol |
| Exact Mass | 242.30 |
| IUPAC Name | 1,4-dimethylcyclohexane;3-methylpentane;propane |
| SMILES | CC1CCC(C)CC1.CCC.CCC(C)CC |
| InChI | InChI=1S/C8H16.C6H14.C3H8/c1-7-3-5-8(2)6-4-7;1-4-6(3)5-2;1-3-2/h7-8H,3-6H2,1-2H3;6H,4-5H2,1-3H3;3H2,1-2H3 |
| InChIKey | PRKVMZMSPORBBT-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.49 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |