C20H48Si4 — CID 140649620
1,2,3,4-tetra(butan-2-yl)-1,2,3,4-tetramethyltetrasiletane (PubChem CID 140649620) has the molecular formula C20H48Si4 and a molecular weight of 400.95 g/mol. Its IUPAC name is 1,2,3,4-tetra(butan-2-yl)-1,2,3,4-tetramethyltetrasiletane.
| Compound Name | 1,2,3,4-tetra(butan-2-yl)-1,2,3,4-tetramethyltetrasiletane |
|---|---|
| PubChem CID | 140649620 |
| Molecular Formula | C20H48Si4 |
| Molecular Weight | 400.95 g/mol |
| Exact Mass | 400.28 |
| IUPAC Name | 1,2,3,4-tetra(butan-2-yl)-1,2,3,4-tetramethyltetrasiletane |
| SMILES | CCC(C)[Si]1(C)[Si](C)(C(C)CC)[Si](C)(C(C)CC)[Si]1(C)C(C)CC |
| InChI | InChI=1S/C20H48Si4/c1-13-17(5)21(9)22(10,18(6)14-2)24(12,20(8)16-4)23(21,11)19(7)15-3/h17-20H,13-16H2,1-12H3 |
| InChIKey | YMHWPHRADNNHOY-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.95 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|