C20H50Si5 — CID 154064392
1,2,3,4,5-penta(butan-2-yl)pentasilolane (PubChem CID 154064392) has the molecular formula C20H50Si5 and a molecular weight of 431.05 g/mol. Its IUPAC name is 1,2,3,4,5-penta(butan-2-yl)pentasilolane.
| Compound Name | 1,2,3,4,5-penta(butan-2-yl)pentasilolane |
|---|---|
| PubChem CID | 154064392 |
| Molecular Formula | C20H50Si5 |
| Molecular Weight | 431.05 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | 1,2,3,4,5-penta(butan-2-yl)pentasilolane |
| SMILES | CCC(C)[SiH]1[SiH](C(C)CC)[SiH](C(C)CC)[SiH](C(C)CC)[SiH]1C(C)CC |
| InChI | InChI=1S/C20H50Si5/c1-11-16(6)21-22(17(7)12-2)24(19(9)14-4)25(20(10)15-5)23(21)18(8)13-3/h16-25H,11-15H2,1-10H3 |
| InChIKey | YBYLVFBUQVKOBW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.05 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|