C4H12O3Si2 — CID 174760038
3-butan-2-yl-1,2,4,3,5-trioxadisilolane (PubChem CID 174760038) has the molecular formula C4H12O3Si2 and a molecular weight of 164.31 g/mol. Its IUPAC name is 3-butan-2-yl-1,2,4,3,5-trioxadisilolane.
| Compound Name | 3-butan-2-yl-1,2,4,3,5-trioxadisilolane |
|---|---|
| PubChem CID | 174760038 |
| Molecular Formula | C4H12O3Si2 |
| Molecular Weight | 164.31 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | 3-butan-2-yl-1,2,4,3,5-trioxadisilolane |
| SMILES | CCC(C)[SiH]1OO[SiH2]O1 |
| InChI | InChI=1S/C4H12O3Si2/c1-3-4(2)9-6-5-8-7-9/h4,9H,3,8H2,1-2H3 |
| InChIKey | QZLJJENMCNIDAT-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.31 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|