About butane-2-tellurol
butane-2-tellurol (PubChem CID 173009567) has the molecular formula C4H10Te
and a molecular weight of 185.72 g/mol. Its IUPAC name is butane-2-tellurol.
Molecular Properties
| Compound Name | butane-2-tellurol |
| PubChem CID | 173009567 |
| Molecular Formula | C4H10Te |
| Molecular Weight | 185.72 g/mol |
| Exact Mass | 187.98 |
| IUPAC Name | butane-2-tellurol |
| SMILES | CCC(C)[TeH] |
| InChI | InChI=1S/C4H10Te/c1-3-4(2)5/h4-5H,3H2,1-2H3 |
| InChIKey | NXKXNBWMZWHUJV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.72 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butane-2-tellurol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2-tellurol?
The IUPAC name of butane-2-tellurol (CID 173009567) is butane-2-tellurol.
What is the SMILES notation for butane-2-tellurol?
The canonical SMILES for butane-2-tellurol is CCC(C)[TeH].
What is the InChIKey of butane-2-tellurol?
The InChIKey is NXKXNBWMZWHUJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10Te/c1-3-4(2)5/h4-5H,3H2,1-2H3.
What are the key properties of butane-2-tellurol?
butane-2-tellurol has a molecular weight of 185.72 g/mol, XLogP of 1.11, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2-tellurol is sourced from PubChem (CID 173009567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).