C12H26 — CID 53423923
4-ethyl-2,7-dimethyloctane (PubChem CID 53423923) has the molecular formula C12H26 and a molecular weight of 170.34 g/mol. Its IUPAC name is 4-ethyl-2,7-dimethyloctane.
| Compound Name | 4-ethyl-2,7-dimethyloctane |
|---|---|
| PubChem CID | 53423923 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | 4-ethyl-2,7-dimethyloctane |
| SMILES | CCC(CCC(C)C)CC(C)C |
| InChI | InChI=1S/C12H26/c1-6-12(9-11(4)5)8-7-10(2)3/h10-12H,6-9H2,1-5H3 |
| InChIKey | KSVMIUVYLYZDMT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |