C14H28 — CID 91215867
6-ethyl-4,9-dimethyldec-2-ene (PubChem CID 91215867) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is 6-ethyl-4,9-dimethyldec-2-ene.
| Compound Name | 6-ethyl-4,9-dimethyldec-2-ene |
|---|---|
| PubChem CID | 91215867 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 6-ethyl-4,9-dimethyldec-2-ene |
| SMILES | CC=CC(C)CC(CC)CCC(C)C |
| InChI | InChI=1S/C14H28/c1-6-8-13(5)11-14(7-2)10-9-12(3)4/h6,8,12-14H,7,9-11H2,1-5H3 |
| InChIKey | OCTZZDSRZMWPSL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|