About (Z)-but-2-ene;2,5-dimethylhexane
(Z)-but-2-ene;2,5-dimethylhexane (PubChem CID 144935211) has the molecular formula C12H26
and a molecular weight of 170.34 g/mol. Its IUPAC name is (Z)-but-2-ene;2,5-dimethylhexane.
Molecular Properties
| Compound Name | (Z)-but-2-ene;2,5-dimethylhexane |
| PubChem CID | 144935211 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | (Z)-but-2-ene;2,5-dimethylhexane |
| SMILES | C/C=C\C.CC(C)CCC(C)C |
| InChI | InChI=1S/C8H18.C4H8/c1-7(2)5-6-8(3)4;1-3-4-2/h7-8H,5-6H2,1-4H3;3-4H,1-2H3/b;4-3- |
| InChIKey | BXNHPGYEKHIWRJ-QGAMPUOQSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-ene;2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-ene;2,5-dimethylhexane?
The IUPAC name of (Z)-but-2-ene;2,5-dimethylhexane (CID 144935211) is (Z)-but-2-ene;2,5-dimethylhexane.
What is the SMILES notation for (Z)-but-2-ene;2,5-dimethylhexane?
The canonical SMILES for (Z)-but-2-ene;2,5-dimethylhexane is C/C=C\C.CC(C)CCC(C)C.
What is the InChIKey of (Z)-but-2-ene;2,5-dimethylhexane?
The InChIKey is BXNHPGYEKHIWRJ-QGAMPUOQSA-N. The full InChI is InChI=1S/C8H18.C4H8/c1-7(2)5-6-8(3)4;1-3-4-2/h7-8H,5-6H2,1-4H3;3-4H,1-2H3/b;4-3-.
What are the key properties of (Z)-but-2-ene;2,5-dimethylhexane?
(Z)-but-2-ene;2,5-dimethylhexane has a molecular weight of 170.34 g/mol, XLogP of 4.66, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-ene;2,5-dimethylhexane is sourced from PubChem (CID 144935211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).