C12H26 — CID 144935211
(Z)-but-2-ene;2,5-dimethylhexane (PubChem CID 144935211) has the molecular formula C12H26 and a molecular weight of 170.34 g/mol. Its IUPAC name is (Z)-but-2-ene;2,5-dimethylhexane.
| Compound Name | (Z)-but-2-ene;2,5-dimethylhexane |
|---|---|
| PubChem CID | 144935211 |
| Molecular Formula | C12H26 |
| Molecular Weight | 170.34 g/mol |
| Exact Mass | 170.20 |
| IUPAC Name | (Z)-but-2-ene;2,5-dimethylhexane |
| SMILES | C/C=C\C.CC(C)CCC(C)C |
| InChI | InChI=1S/C8H18.C4H8/c1-7(2)5-6-8(3)4;1-3-4-2/h7-8H,5-6H2,1-4H3;3-4H,1-2H3/b;4-3- |
| InChIKey | BXNHPGYEKHIWRJ-QGAMPUOQSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.34 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|