C22H46 — CID 139994880
2,9-dimethyl-5,6-bis(3-methylbutyl)decane (PubChem CID 139994880) has the molecular formula C22H46 and a molecular weight of 310.61 g/mol. Its IUPAC name is 2,9-dimethyl-5,6-bis(3-methylbutyl)decane.
| Compound Name | 2,9-dimethyl-5,6-bis(3-methylbutyl)decane |
|---|---|
| PubChem CID | 139994880 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 2,9-dimethyl-5,6-bis(3-methylbutyl)decane |
| SMILES | CC(C)CCC(CCC(C)C)C(CCC(C)C)CCC(C)C |
| InChI | InChI=1S/C22H46/c1-17(2)9-13-21(14-10-18(3)4)22(15-11-19(5)6)16-12-20(7)8/h17-22H,9-16H2,1-8H3 |
| InChIKey | BYIWEZIVKROSFA-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |