C16H34 — CID 160891186
2,5-dimethylhexane;(E)-2,5-dimethylhex-3-ene (PubChem CID 160891186) has the molecular formula C16H34 and a molecular weight of 226.45 g/mol. Its IUPAC name is 2,5-dimethylhexane;(E)-2,5-dimethylhex-3-ene.
| Compound Name | 2,5-dimethylhexane;(E)-2,5-dimethylhex-3-ene |
|---|---|
| PubChem CID | 160891186 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 2,5-dimethylhexane;(E)-2,5-dimethylhex-3-ene |
| SMILES | CC(C)/C=C/C(C)C.CC(C)CCC(C)C |
| InChI | InChI=1S/C8H18.C8H16/c2*1-7(2)5-6-8(3)4/h7-8H,5-6H2,1-4H3;5-8H,1-4H3/b;6-5+ |
| InChIKey | SOHDWIULEOVELF-MXDQRGINSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|