About CID 57433789
CID 57433789 (PubChem CID 57433789) has the molecular formula C9H19
and a molecular weight of 127.25 g/mol.
Molecular Properties
| Compound Name | CID 57433789 |
| PubChem CID | 57433789 |
| Molecular Formula | C9H19 |
| Molecular Weight | 127.25 g/mol |
| Exact Mass | 127.15 |
| IUPAC Name | — |
| SMILES | CC(C)[CH]CCC(C)C |
| InChI | InChI=1S/C9H19/c1-8(2)6-5-7-9(3)4/h6,8-9H,5,7H2,1-4H3 |
| InChIKey | WPSVHVLIHCVMSF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.25 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 57433789 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57433789?
The IUPAC name of CID 57433789 (CID 57433789) is not available.
What is the SMILES notation for CID 57433789?
The canonical SMILES for CID 57433789 is CC(C)[CH]CCC(C)C.
What is the InChIKey of CID 57433789?
The InChIKey is WPSVHVLIHCVMSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19/c1-8(2)6-5-7-9(3)4/h6,8-9H,5,7H2,1-4H3.
What are the key properties of CID 57433789?
CID 57433789 has a molecular weight of 127.25 g/mol, XLogP of 3.28, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57433789 is sourced from PubChem (CID 57433789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).