About 5-methylhex-1-en-1-amine
5-methylhex-1-en-1-amine (PubChem CID 87108942) has the molecular formula C7H15N
and a molecular weight of 113.20 g/mol. Its IUPAC name is 5-methylhex-1-en-1-amine.
Molecular Properties
| Compound Name | 5-methylhex-1-en-1-amine |
| PubChem CID | 87108942 |
| Molecular Formula | C7H15N |
| Molecular Weight | 113.20 g/mol |
| Exact Mass | 113.12 |
| IUPAC Name | 5-methylhex-1-en-1-amine |
| SMILES | CC(C)CCC=CN |
| InChI | InChI=1S/C7H15N/c1-7(2)5-3-4-6-8/h4,6-7H,3,5,8H2,1-2H3 |
| InChIKey | LPQBSDSWUJZGLA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.20 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-methylhex-1-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhex-1-en-1-amine?
The IUPAC name of 5-methylhex-1-en-1-amine (CID 87108942) is 5-methylhex-1-en-1-amine.
What is the SMILES notation for 5-methylhex-1-en-1-amine?
The canonical SMILES for 5-methylhex-1-en-1-amine is CC(C)CCC=CN.
What is the InChIKey of 5-methylhex-1-en-1-amine?
The InChIKey is LPQBSDSWUJZGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N/c1-7(2)5-3-4-6-8/h4,6-7H,3,5,8H2,1-2H3.
What are the key properties of 5-methylhex-1-en-1-amine?
5-methylhex-1-en-1-amine has a molecular weight of 113.20 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhex-1-en-1-amine is sourced from PubChem (CID 87108942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).