About (E)-6-aminohex-5-ene-1,1-diol
(E)-6-aminohex-5-ene-1,1-diol (PubChem CID 163840994) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is (E)-6-aminohex-5-ene-1,1-diol.
Molecular Properties
| Compound Name | (E)-6-aminohex-5-ene-1,1-diol |
| PubChem CID | 163840994 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (E)-6-aminohex-5-ene-1,1-diol |
| SMILES | N/C=C/CCCC(O)O |
| InChI | InChI=1S/C6H13NO2/c7-5-3-1-2-4-6(8)9/h3,5-6,8-9H,1-2,4,7H2/b5-3+ |
| InChIKey | OLZFTZFHHKWEQI-HWKANZROSA-N |
| XLogP | -0.06 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (E)-6-aminohex-5-ene-1,1-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-6-aminohex-5-ene-1,1-diol?
The IUPAC name of (E)-6-aminohex-5-ene-1,1-diol (CID 163840994) is (E)-6-aminohex-5-ene-1,1-diol.
What is the SMILES notation for (E)-6-aminohex-5-ene-1,1-diol?
The canonical SMILES for (E)-6-aminohex-5-ene-1,1-diol is N/C=C/CCCC(O)O.
What is the InChIKey of (E)-6-aminohex-5-ene-1,1-diol?
The InChIKey is OLZFTZFHHKWEQI-HWKANZROSA-N. The full InChI is InChI=1S/C6H13NO2/c7-5-3-1-2-4-6(8)9/h3,5-6,8-9H,1-2,4,7H2/b5-3+.
What are the key properties of (E)-6-aminohex-5-ene-1,1-diol?
(E)-6-aminohex-5-ene-1,1-diol has a molecular weight of 131.18 g/mol, XLogP of -0.06, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-6-aminohex-5-ene-1,1-diol is sourced from PubChem (CID 163840994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).