C6H14N2 — CID 88688497
(E)-hex-1-ene-1,5-diamine (PubChem CID 88688497) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is (E)-hex-1-ene-1,5-diamine.
| Compound Name | (E)-hex-1-ene-1,5-diamine |
|---|---|
| PubChem CID | 88688497 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | (E)-hex-1-ene-1,5-diamine |
| SMILES | CC(N)CC/C=C/N |
| InChI | InChI=1S/C6H14N2/c1-6(8)4-2-3-5-7/h3,5-6H,2,4,7-8H2,1H3/b5-3+ |
| InChIKey | XVCWWQTUGHJJBN-HWKANZROSA-N |
| XLogP | 0.59 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |