C8H20N2 — CID 174083116
(2R,3S)-3-methylheptane-2,6-diamine (PubChem CID 174083116) has the molecular formula C8H20N2 and a molecular weight of 144.26 g/mol. Its IUPAC name is (2R,3S)-3-methylheptane-2,6-diamine.
| Compound Name | (2R,3S)-3-methylheptane-2,6-diamine |
|---|---|
| PubChem CID | 174083116 |
| Molecular Formula | C8H20N2 |
| Molecular Weight | 144.26 g/mol |
| Exact Mass | 144.16 |
| IUPAC Name | (2R,3S)-3-methylheptane-2,6-diamine |
| SMILES | CC(N)CC[C@H](C)[C@@H](C)N |
| InChI | InChI=1S/C8H20N2/c1-6(8(3)10)4-5-7(2)9/h6-8H,4-5,9-10H2,1-3H3/t6-,7?,8+/m0/s1 |
| InChIKey | WTQZTJHGJSNPGT-YPVSKDHRSA-N |
| XLogP | 1.10 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.26 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |