C5H14N2O — CID 87068765
4,4-diamino-3-methylbutan-1-ol (PubChem CID 87068765) has the molecular formula C5H14N2O and a molecular weight of 118.18 g/mol. Its IUPAC name is 4,4-diamino-3-methylbutan-1-ol.
| Compound Name | 4,4-diamino-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 87068765 |
| Molecular Formula | C5H14N2O |
| Molecular Weight | 118.18 g/mol |
| Exact Mass | 118.11 |
| IUPAC Name | 4,4-diamino-3-methylbutan-1-ol |
| SMILES | CC(CCO)C(N)N |
| InChI | InChI=1S/C5H14N2O/c1-4(2-3-8)5(6)7/h4-5,8H,2-3,6-7H2,1H3 |
| InChIKey | ZGTFWCBAVYFFNL-UHFFFAOYSA-N |
| XLogP | -0.75 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.18 |
| LogP ≤ 5 | -0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|