About 3-aminopentane-1,4-diol
3-aminopentane-1,4-diol (PubChem CID 23064801) has the molecular formula C5H13NO2
and a molecular weight of 119.16 g/mol. Its IUPAC name is 3-aminopentane-1,4-diol.
Molecular Properties
| Compound Name | 3-aminopentane-1,4-diol |
| PubChem CID | 23064801 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | 3-aminopentane-1,4-diol |
| SMILES | CC(O)C(N)CCO |
| InChI | InChI=1S/C5H13NO2/c1-4(8)5(6)2-3-7/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | VUEXEZAJGCYGFI-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-aminopentane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopentane-1,4-diol?
The IUPAC name of 3-aminopentane-1,4-diol (CID 23064801) is 3-aminopentane-1,4-diol.
What is the SMILES notation for 3-aminopentane-1,4-diol?
The canonical SMILES for 3-aminopentane-1,4-diol is CC(O)C(N)CCO.
What is the InChIKey of 3-aminopentane-1,4-diol?
The InChIKey is VUEXEZAJGCYGFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NO2/c1-4(8)5(6)2-3-7/h4-5,7-8H,2-3,6H2,1H3.
What are the key properties of 3-aminopentane-1,4-diol?
3-aminopentane-1,4-diol has a molecular weight of 119.16 g/mol, XLogP of -0.92, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopentane-1,4-diol is sourced from PubChem (CID 23064801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).