C5H13NO2 — CID 23064801
3-aminopentane-1,4-diol (PubChem CID 23064801) has the molecular formula C5H13NO2 and a molecular weight of 119.16 g/mol. Its IUPAC name is 3-aminopentane-1,4-diol.
| Compound Name | 3-aminopentane-1,4-diol |
|---|---|
| PubChem CID | 23064801 |
| Molecular Formula | C5H13NO2 |
| Molecular Weight | 119.16 g/mol |
| Exact Mass | 119.09 |
| IUPAC Name | 3-aminopentane-1,4-diol |
| SMILES | CC(O)C(N)CCO |
| InChI | InChI=1S/C5H13NO2/c1-4(8)5(6)2-3-7/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | VUEXEZAJGCYGFI-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.16 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |