C7H17NO3 — CID 142060035
3-amino-5-methoxyhexane-1,4-diol (PubChem CID 142060035) has the molecular formula C7H17NO3 and a molecular weight of 163.22 g/mol. Its IUPAC name is 3-amino-5-methoxyhexane-1,4-diol.
| Compound Name | 3-amino-5-methoxyhexane-1,4-diol |
|---|---|
| PubChem CID | 142060035 |
| Molecular Formula | C7H17NO3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.12 |
| IUPAC Name | 3-amino-5-methoxyhexane-1,4-diol |
| SMILES | COC(C)C(O)C(N)CCO |
| InChI | InChI=1S/C7H17NO3/c1-5(11-2)7(10)6(8)3-4-9/h5-7,9-10H,3-4,8H2,1-2H3 |
| InChIKey | PAGPLBFKFUJXLB-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |