C9H20O5 — CID 123325898
5,6-dimethoxyheptane-1,3,4-triol (PubChem CID 123325898) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is 5,6-dimethoxyheptane-1,3,4-triol.
| Compound Name | 5,6-dimethoxyheptane-1,3,4-triol |
|---|---|
| PubChem CID | 123325898 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5,6-dimethoxyheptane-1,3,4-triol |
| SMILES | COC(C)C(OC)C(O)C(O)CCO |
| InChI | InChI=1S/C9H20O5/c1-6(13-2)9(14-3)8(12)7(11)4-5-10/h6-12H,4-5H2,1-3H3 |
| InChIKey | WXEYZVLWPSTMQR-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |