About 5,6-dimethoxyheptane-1,3,4-triol
5,6-dimethoxyheptane-1,3,4-triol (PubChem CID 123325898) has the molecular formula C9H20O5
and a molecular weight of 208.25 g/mol. Its IUPAC name is 5,6-dimethoxyheptane-1,3,4-triol.
Molecular Properties
| Compound Name | 5,6-dimethoxyheptane-1,3,4-triol |
| PubChem CID | 123325898 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 5,6-dimethoxyheptane-1,3,4-triol |
| SMILES | COC(C)C(OC)C(O)C(O)CCO |
| InChI | InChI=1S/C9H20O5/c1-6(13-2)9(14-3)8(12)7(11)4-5-10/h6-12H,4-5H2,1-3H3 |
| InChIKey | WXEYZVLWPSTMQR-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5,6-dimethoxyheptane-1,3,4-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethoxyheptane-1,3,4-triol?
The IUPAC name of 5,6-dimethoxyheptane-1,3,4-triol (CID 123325898) is 5,6-dimethoxyheptane-1,3,4-triol.
What is the SMILES notation for 5,6-dimethoxyheptane-1,3,4-triol?
The canonical SMILES for 5,6-dimethoxyheptane-1,3,4-triol is COC(C)C(OC)C(O)C(O)CCO.
What is the InChIKey of 5,6-dimethoxyheptane-1,3,4-triol?
The InChIKey is WXEYZVLWPSTMQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O5/c1-6(13-2)9(14-3)8(12)7(11)4-5-10/h6-12H,4-5H2,1-3H3.
What are the key properties of 5,6-dimethoxyheptane-1,3,4-triol?
5,6-dimethoxyheptane-1,3,4-triol has a molecular weight of 208.25 g/mol, XLogP of -0.86, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethoxyheptane-1,3,4-triol is sourced from PubChem (CID 123325898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).