C8H17NO2 — CID 142227151
3,5-dihydroxy-2-methylpentanenitrile;ethane (PubChem CID 142227151) has the molecular formula C8H17NO2 and a molecular weight of 159.23 g/mol. Its IUPAC name is 3,5-dihydroxy-2-methylpentanenitrile;ethane.
| Compound Name | 3,5-dihydroxy-2-methylpentanenitrile;ethane |
|---|---|
| PubChem CID | 142227151 |
| Molecular Formula | C8H17NO2 |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.13 |
| IUPAC Name | 3,5-dihydroxy-2-methylpentanenitrile;ethane |
| SMILES | CC.CC(C#N)C(O)CCO |
| InChI | InChI=1S/C6H11NO2.C2H6/c1-5(4-7)6(9)2-3-8;1-2/h5-6,8-9H,2-3H2,1H3;1-2H3 |
| InChIKey | UNXZWKFCQHTOPY-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 64.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |