C9H20O5 — CID 10035953
(2R,3R)-2-(2,2-dimethoxyethyl)pentane-1,3,5-triol (PubChem CID 10035953) has the molecular formula C9H20O5 and a molecular weight of 208.25 g/mol. Its IUPAC name is (2R,3R)-2-(2,2-dimethoxyethyl)pentane-1,3,5-triol.
| Compound Name | (2R,3R)-2-(2,2-dimethoxyethyl)pentane-1,3,5-triol |
|---|---|
| PubChem CID | 10035953 |
| Molecular Formula | C9H20O5 |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | (2R,3R)-2-(2,2-dimethoxyethyl)pentane-1,3,5-triol |
| SMILES | COC(CC(CO)[C@H](O)CCO)OC |
| InChI | InChI=1S/C9H20O5/c1-13-9(14-2)5-7(6-11)8(12)3-4-10/h7-12H,3-6H2,1-2H3/t7?,8-/m1/s1 |
| InChIKey | FZJSGACCCJOEJA-BRFYHDHCSA-N |
| XLogP | -0.65 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|