C4H12O6P+ — CID 174701036
dihydroxy(oxo)phosphanium;2,2-dimethoxyethanol (PubChem CID 174701036) has the molecular formula C4H12O6P+ and a molecular weight of 187.11 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;2,2-dimethoxyethanol.
| Compound Name | dihydroxy(oxo)phosphanium;2,2-dimethoxyethanol |
|---|---|
| PubChem CID | 174701036 |
| Molecular Formula | C4H12O6P+ |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 187.04 |
| IUPAC Name | dihydroxy(oxo)phosphanium;2,2-dimethoxyethanol |
| SMILES | COC(CO)OC.O=[P+](O)O |
| InChI | InChI=1S/C4H10O3.HO3P/c1-6-4(3-5)7-2;1-4(2)3/h4-5H,3H2,1-2H3;(H-,1,2,3)/p+1 |
| InChIKey | SFSAYGNCLFUXJO-UHFFFAOYSA-O |
| XLogP | -0.77 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|