About 2-(3,3-dimethoxypropyl)propane-1,3-diol
2-(3,3-dimethoxypropyl)propane-1,3-diol (PubChem CID 19350817) has the molecular formula C8H18O4
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(3,3-dimethoxypropyl)propane-1,3-diol.
Molecular Properties
| Compound Name | 2-(3,3-dimethoxypropyl)propane-1,3-diol |
| PubChem CID | 19350817 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-(3,3-dimethoxypropyl)propane-1,3-diol |
| SMILES | COC(CCC(CO)CO)OC |
| InChI | InChI=1S/C8H18O4/c1-11-8(12-2)4-3-7(5-9)6-10/h7-10H,3-6H2,1-2H3 |
| InChIKey | DAEXVTNOWGFBGT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,3-dimethoxypropyl)propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dimethoxypropyl)propane-1,3-diol?
The IUPAC name of 2-(3,3-dimethoxypropyl)propane-1,3-diol (CID 19350817) is 2-(3,3-dimethoxypropyl)propane-1,3-diol.
What is the SMILES notation for 2-(3,3-dimethoxypropyl)propane-1,3-diol?
The canonical SMILES for 2-(3,3-dimethoxypropyl)propane-1,3-diol is COC(CCC(CO)CO)OC.
What is the InChIKey of 2-(3,3-dimethoxypropyl)propane-1,3-diol?
The InChIKey is DAEXVTNOWGFBGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18O4/c1-11-8(12-2)4-3-7(5-9)6-10/h7-10H,3-6H2,1-2H3.
What are the key properties of 2-(3,3-dimethoxypropyl)propane-1,3-diol?
2-(3,3-dimethoxypropyl)propane-1,3-diol has a molecular weight of 178.23 g/mol, XLogP of -0.01, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethoxypropyl)propane-1,3-diol is sourced from PubChem (CID 19350817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).