C8H18O4 — CID 19350817
2-(3,3-dimethoxypropyl)propane-1,3-diol (PubChem CID 19350817) has the molecular formula C8H18O4 and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(3,3-dimethoxypropyl)propane-1,3-diol.
| Compound Name | 2-(3,3-dimethoxypropyl)propane-1,3-diol |
|---|---|
| PubChem CID | 19350817 |
| Molecular Formula | C8H18O4 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 2-(3,3-dimethoxypropyl)propane-1,3-diol |
| SMILES | COC(CCC(CO)CO)OC |
| InChI | InChI=1S/C8H18O4/c1-11-8(12-2)4-3-7(5-9)6-10/h7-10H,3-6H2,1-2H3 |
| InChIKey | DAEXVTNOWGFBGT-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|