2-(3,3-dimethoxypropyl)propanedioic acid

C8H14O6 — CID 88660648

IUPAC2-(3,3-dimethoxypropyl)propanedioic acid
SMILESCOC(CCC(C(=O)O)C(=O)O)OC
InChIInChI=1S/C8H14O6/c1-13-6(14-2)4-3-5(7(9)10)8(11)12/h5-6H,3-4H2,1-2H3,(H,9,10)(H,11,12)
InChIKeyJSFCMHLCPVXYLT-UHFFFAOYSA-N
MW206.19 g/mol
LogP0.17
Rot. Bonds7

About 2-(3,3-dimethoxypropyl)propanedioic acid

2-(3,3-dimethoxypropyl)propanedioic acid (PubChem CID 88660648) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is 2-(3,3-dimethoxypropyl)propanedioic acid.

Molecular Properties

Compound Name2-(3,3-dimethoxypropyl)propanedioic acid
PubChem CID88660648
Molecular FormulaC8H14O6
Molecular Weight206.19 g/mol
Exact Mass206.08
IUPAC Name2-(3,3-dimethoxypropyl)propanedioic acid
SMILESCOC(CCC(C(=O)O)C(=O)O)OC
InChIInChI=1S/C8H14O6/c1-13-6(14-2)4-3-5(7(9)10)8(11)12/h5-6H,3-4H2,1-2H3,(H,9,10)(H,11,12)
InChIKeyJSFCMHLCPVXYLT-UHFFFAOYSA-N
XLogP0.17
TPSA93.06 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.19
LogP ≤ 50.17
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-(3,3-dimethoxypropyl)propanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3-dimethoxypropyl)propanedioic acid?
The IUPAC name of 2-(3,3-dimethoxypropyl)propanedioic acid (CID 88660648) is 2-(3,3-dimethoxypropyl)propanedioic acid.
What is the SMILES notation for 2-(3,3-dimethoxypropyl)propanedioic acid?
The canonical SMILES for 2-(3,3-dimethoxypropyl)propanedioic acid is COC(CCC(C(=O)O)C(=O)O)OC.
What is the InChIKey of 2-(3,3-dimethoxypropyl)propanedioic acid?
The InChIKey is JSFCMHLCPVXYLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O6/c1-13-6(14-2)4-3-5(7(9)10)8(11)12/h5-6H,3-4H2,1-2H3,(H,9,10)(H,11,12).
What are the key properties of 2-(3,3-dimethoxypropyl)propanedioic acid?
2-(3,3-dimethoxypropyl)propanedioic acid has a molecular weight of 206.19 g/mol, XLogP of 0.17, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethoxypropyl)propanedioic acid is sourced from PubChem (CID 88660648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).