C8H14O6 — CID 88660648
2-(3,3-dimethoxypropyl)propanedioic acid (PubChem CID 88660648) has the molecular formula C8H14O6 and a molecular weight of 206.19 g/mol. Its IUPAC name is 2-(3,3-dimethoxypropyl)propanedioic acid.
| Compound Name | 2-(3,3-dimethoxypropyl)propanedioic acid |
|---|---|
| PubChem CID | 88660648 |
| Molecular Formula | C8H14O6 |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 2-(3,3-dimethoxypropyl)propanedioic acid |
| SMILES | COC(CCC(C(=O)O)C(=O)O)OC |
| InChI | InChI=1S/C8H14O6/c1-13-6(14-2)4-3-5(7(9)10)8(11)12/h5-6H,3-4H2,1-2H3,(H,9,10)(H,11,12) |
| InChIKey | JSFCMHLCPVXYLT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|