C29H44O8 — CID 159425765
(2S)-5,5-dimethoxy-2-methylpentanoic acid;methane;(2S)-2-methyl-5,5-bis(phenylmethoxy)pentanoic acid (PubChem CID 159425765) has the molecular formula C29H44O8 and a molecular weight of 520.66 g/mol. Its IUPAC name is (2S)-5,5-dimethoxy-2-methylpentanoic acid;methane;(2S)-2-methyl-5,5-bis(phenylmethoxy)pentanoic acid.
| Compound Name | (2S)-5,5-dimethoxy-2-methylpentanoic acid;methane;(2S)-2-methyl-5,5-bis(phenylmethoxy)pentanoic acid |
|---|---|
| PubChem CID | 159425765 |
| Molecular Formula | C29H44O8 |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | (2S)-5,5-dimethoxy-2-methylpentanoic acid;methane;(2S)-2-methyl-5,5-bis(phenylmethoxy)pentanoic acid |
| SMILES | C.COC(CC[C@H](C)C(=O)O)OC.C[C@@H](CCC(OCc1ccccc1)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H24O4.C8H16O4.CH4/c1-16(20(21)22)12-13-19(23-14-17-8-4-2-5-9-17)24-15-18-10-6-3-7-11-18;1-6(8(9)10)4-5-7(11-2)12-3;/h2-11,16,19H,12-15H2,1H3,(H,21,22);6-7H,4-5H2,1-3H3,(H,9,10);1H4/t16-;6-;/m00./s1 |
| InChIKey | LQIFXWIULHDVJM-RQAUTVFTSA-N |
| XLogP | 5.99 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|