C24H38N2O5 — CID 143366732
6-[[hydroxy(phenylmethoxy)methyl]amino]-2-methylhexanoic acid;methanamine;methoxymethylbenzene (PubChem CID 143366732) has the molecular formula C24H38N2O5 and a molecular weight of 434.58 g/mol. Its IUPAC name is 6-[[hydroxy(phenylmethoxy)methyl]amino]-2-methylhexanoic acid;methanamine;methoxymethylbenzene.
| Compound Name | 6-[[hydroxy(phenylmethoxy)methyl]amino]-2-methylhexanoic acid;methanamine;methoxymethylbenzene |
|---|---|
| PubChem CID | 143366732 |
| Molecular Formula | C24H38N2O5 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 6-[[hydroxy(phenylmethoxy)methyl]amino]-2-methylhexanoic acid;methanamine;methoxymethylbenzene |
| SMILES | CC(CCCCNC(O)OCc1ccccc1)C(=O)O.CN.COCc1ccccc1 |
| InChI | InChI=1S/C15H23NO4.C8H10O.CH5N/c1-12(14(17)18)7-5-6-10-16-15(19)20-11-13-8-3-2-4-9-13;1-9-7-8-5-3-2-4-6-8;1-2/h2-4,8-9,12,15-16,19H,5-7,10-11H2,1H3,(H,17,18);2-6H,7H2,1H3;2H2,1H3 |
| InChIKey | TVVNHLWFARKKDO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|