C19H31N3O8S — CID 143593043
(2S)-2-[[hydroxy(phenylmethoxy)methyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]hexanoic acid (PubChem CID 143593043) has the molecular formula C19H31N3O8S and a molecular weight of 461.54 g/mol. Its IUPAC name is (2S)-2-[[hydroxy(phenylmethoxy)methyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]hexanoic acid.
| Compound Name | (2S)-2-[[hydroxy(phenylmethoxy)methyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 143593043 |
| Molecular Formula | C19H31N3O8S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | (2S)-2-[[hydroxy(phenylmethoxy)methyl]amino]-6-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]hexanoic acid |
| SMILES | CC(C)(C)OC(=O)NS(=O)(=O)NCCCC[C@H](NC(O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C19H31N3O8S/c1-19(2,3)30-18(26)22-31(27,28)20-12-8-7-11-15(16(23)24)21-17(25)29-13-14-9-5-4-6-10-14/h4-6,9-10,15,17,20-21,25H,7-8,11-13H2,1-3H3,(H,22,26)(H,23,24)/t15-,17?/m0/s1 |
| InChIKey | CPAKDTBCJUHHPO-MYJWUSKBSA-N |
| XLogP | 1.05 |
| TPSA | 163.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|