C15H29N3O8S — CID 59028983
methyl (2S)-2-(ethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]hexanoate (PubChem CID 59028983) has the molecular formula C15H29N3O8S and a molecular weight of 411.48 g/mol. Its IUPAC name is methyl (2S)-2-(ethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]hexanoate.
| Compound Name | methyl (2S)-2-(ethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]hexanoate |
|---|---|
| PubChem CID | 59028983 |
| Molecular Formula | C15H29N3O8S |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | methyl (2S)-2-(ethoxycarbonylamino)-6-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]hexanoate |
| SMILES | CCOC(=O)N[C@@H](CCCCNS(=O)(=O)NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C15H29N3O8S/c1-6-25-13(20)17-11(12(19)24-5)9-7-8-10-16-27(22,23)18-14(21)26-15(2,3)4/h11,16H,6-10H2,1-5H3,(H,17,20)(H,18,21)/t11-/m0/s1 |
| InChIKey | LDOYPIKNXHABBO-NSHDSACASA-N |
| XLogP | 0.80 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|