C20H33N3O4 — CID 71028447
2-[(1-amino-2-phenylpropyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid (PubChem CID 71028447) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is 2-[(1-amino-2-phenylpropyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid.
| Compound Name | 2-[(1-amino-2-phenylpropyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 71028447 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | 2-[(1-amino-2-phenylpropyl)amino]-6-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
| SMILES | CC(c1ccccc1)C(N)NC(CCCCNC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C20H33N3O4/c1-14(15-10-6-5-7-11-15)17(21)23-16(18(24)25)12-8-9-13-22-19(26)27-20(2,3)4/h5-7,10-11,14,16-17,23H,8-9,12-13,21H2,1-4H3,(H,22,26)(H,24,25) |
| InChIKey | NARZMYKGYRAAIH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|