C20H26F3NO6 — CID 70031580
6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2,2,2-trifluoro-1-phenylethoxy)carbonylhexanoic acid (PubChem CID 70031580) has the molecular formula C20H26F3NO6 and a molecular weight of 433.42 g/mol. Its IUPAC name is 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2,2,2-trifluoro-1-phenylethoxy)carbonylhexanoic acid.
| Compound Name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2,2,2-trifluoro-1-phenylethoxy)carbonylhexanoic acid |
|---|---|
| PubChem CID | 70031580 |
| Molecular Formula | C20H26F3NO6 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 6-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2,2,2-trifluoro-1-phenylethoxy)carbonylhexanoic acid |
| SMILES | CC(C)(C)OC(=O)NCCCCC(C(=O)O)C(=O)OC(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H26F3NO6/c1-19(2,3)30-18(28)24-12-8-7-11-14(16(25)26)17(27)29-15(20(21,22)23)13-9-5-4-6-10-13/h4-6,9-10,14-15H,7-8,11-12H2,1-3H3,(H,24,28)(H,25,26) |
| InChIKey | ATKPATRAGIZCHE-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|