C31H48O8 — CID 159051521
(2S)-2-ethyl-5,5-bis(phenylmethoxy)pentanoic acid;(2S)-2-ethyl-5,5-dimethoxypentanoic acid;methane (PubChem CID 159051521) has the molecular formula C31H48O8 and a molecular weight of 548.72 g/mol. Its IUPAC name is (2S)-2-ethyl-5,5-bis(phenylmethoxy)pentanoic acid;(2S)-2-ethyl-5,5-dimethoxypentanoic acid;methane.
| Compound Name | (2S)-2-ethyl-5,5-bis(phenylmethoxy)pentanoic acid;(2S)-2-ethyl-5,5-dimethoxypentanoic acid;methane |
|---|---|
| PubChem CID | 159051521 |
| Molecular Formula | C31H48O8 |
| Molecular Weight | 548.72 g/mol |
| Exact Mass | 548.33 |
| IUPAC Name | (2S)-2-ethyl-5,5-bis(phenylmethoxy)pentanoic acid;(2S)-2-ethyl-5,5-dimethoxypentanoic acid;methane |
| SMILES | C.CC[C@@H](CCC(OC)OC)C(=O)O.CC[C@@H](CCC(OCc1ccccc1)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C21H26O4.C9H18O4.CH4/c1-2-19(21(22)23)13-14-20(24-15-17-9-5-3-6-10-17)25-16-18-11-7-4-8-12-18;1-4-7(9(10)11)5-6-8(12-2)13-3;/h3-12,19-20H,2,13-16H2,1H3,(H,22,23);7-8H,4-6H2,1-3H3,(H,10,11);1H4/t19-;7-;/m00./s1 |
| InChIKey | JXIBHIKRVKEOIX-XZMUESKPSA-N |
| XLogP | 6.77 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.72 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|