About 2-ethyl-4-phenylbutanoic acid;hydrochloride
2-ethyl-4-phenylbutanoic acid;hydrochloride (PubChem CID 174946521) has the molecular formula C12H17ClO2
and a molecular weight of 228.72 g/mol. Its IUPAC name is 2-ethyl-4-phenylbutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 2-ethyl-4-phenylbutanoic acid;hydrochloride |
| PubChem CID | 174946521 |
| Molecular Formula | C12H17ClO2 |
| Molecular Weight | 228.72 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 2-ethyl-4-phenylbutanoic acid;hydrochloride |
| SMILES | CCC(CCc1ccccc1)C(=O)O.Cl |
| InChI | InChI=1S/C12H16O2.ClH/c1-2-11(12(13)14)9-8-10-6-4-3-5-7-10;/h3-7,11H,2,8-9H2,1H3,(H,13,14);1H |
| InChIKey | GNUBWJREPZFKBZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.72 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-4-phenylbutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-phenylbutanoic acid;hydrochloride?
The IUPAC name of 2-ethyl-4-phenylbutanoic acid;hydrochloride (CID 174946521) is 2-ethyl-4-phenylbutanoic acid;hydrochloride.
What is the SMILES notation for 2-ethyl-4-phenylbutanoic acid;hydrochloride?
The canonical SMILES for 2-ethyl-4-phenylbutanoic acid;hydrochloride is CCC(CCc1ccccc1)C(=O)O.Cl.
What is the InChIKey of 2-ethyl-4-phenylbutanoic acid;hydrochloride?
The InChIKey is GNUBWJREPZFKBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O2.ClH/c1-2-11(12(13)14)9-8-10-6-4-3-5-7-10;/h3-7,11H,2,8-9H2,1H3,(H,13,14);1H.
What are the key properties of 2-ethyl-4-phenylbutanoic acid;hydrochloride?
2-ethyl-4-phenylbutanoic acid;hydrochloride has a molecular weight of 228.72 g/mol, XLogP of 3.15, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-phenylbutanoic acid;hydrochloride is sourced from PubChem (CID 174946521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).