C19H30O — CID 101041675
(3S,7R)-3,7-diethyl-9-phenylnonan-2-one (PubChem CID 101041675) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (3S,7R)-3,7-diethyl-9-phenylnonan-2-one.
| Compound Name | (3S,7R)-3,7-diethyl-9-phenylnonan-2-one |
|---|---|
| PubChem CID | 101041675 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (3S,7R)-3,7-diethyl-9-phenylnonan-2-one |
| SMILES | CC[C@H](CCC[C@H](CC)C(C)=O)CCc1ccccc1 |
| InChI | InChI=1S/C19H30O/c1-4-17(12-9-13-19(5-2)16(3)20)14-15-18-10-7-6-8-11-18/h6-8,10-11,17,19H,4-5,9,12-15H2,1-3H3/t17-,19+/m1/s1 |
| InChIKey | VGHMBMCQWSCFEH-MJGOQNOKSA-N |
| XLogP | 5.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |