About alumane;3-benzylpentan-2-one
alumane;3-benzylpentan-2-one (PubChem CID 174773852) has the molecular formula C12H19AlO
and a molecular weight of 206.27 g/mol. Its IUPAC name is alumane;3-benzylpentan-2-one.
Molecular Properties
| Compound Name | alumane;3-benzylpentan-2-one |
| PubChem CID | 174773852 |
| Molecular Formula | C12H19AlO |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | alumane;3-benzylpentan-2-one |
| SMILES | CCC(Cc1ccccc1)C(C)=O.[AlH3] |
| InChI | InChI=1S/C12H16O.Al.3H/c1-3-12(10(2)13)9-11-7-5-4-6-8-11;;;;/h4-8,12H,3,9H2,1-2H3;;;; |
| InChIKey | SOMMGYWZXSLHDC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze alumane;3-benzylpentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;3-benzylpentan-2-one?
The IUPAC name of alumane;3-benzylpentan-2-one (CID 174773852) is alumane;3-benzylpentan-2-one.
What is the SMILES notation for alumane;3-benzylpentan-2-one?
The canonical SMILES for alumane;3-benzylpentan-2-one is CCC(Cc1ccccc1)C(C)=O.[AlH3].
What is the InChIKey of alumane;3-benzylpentan-2-one?
The InChIKey is SOMMGYWZXSLHDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O.Al.3H/c1-3-12(10(2)13)9-11-7-5-4-6-8-11;;;;/h4-8,12H,3,9H2,1-2H3;;;;.
What are the key properties of alumane;3-benzylpentan-2-one?
alumane;3-benzylpentan-2-one has a molecular weight of 206.27 g/mol, XLogP of 1.66, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;3-benzylpentan-2-one is sourced from PubChem (CID 174773852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).