About 3-benzylhexan-2-one
3-benzylhexan-2-one (PubChem CID 12816361) has the molecular formula C13H18O
and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-benzylhexan-2-one.
Molecular Properties
| Compound Name | 3-benzylhexan-2-one |
| PubChem CID | 12816361 |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 3-benzylhexan-2-one |
| SMILES | CCCC(Cc1ccccc1)C(C)=O |
| InChI | InChI=1S/C13H18O/c1-3-7-13(11(2)14)10-12-8-5-4-6-9-12/h4-6,8-9,13H,3,7,10H2,1-2H3 |
| InChIKey | OCXPAELLXYZQHT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzylhexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzylhexan-2-one?
The IUPAC name of 3-benzylhexan-2-one (CID 12816361) is 3-benzylhexan-2-one.
What is the SMILES notation for 3-benzylhexan-2-one?
The canonical SMILES for 3-benzylhexan-2-one is CCCC(Cc1ccccc1)C(C)=O.
What is the InChIKey of 3-benzylhexan-2-one?
The InChIKey is OCXPAELLXYZQHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O/c1-3-7-13(11(2)14)10-12-8-5-4-6-9-12/h4-6,8-9,13H,3,7,10H2,1-2H3.
What are the key properties of 3-benzylhexan-2-one?
3-benzylhexan-2-one has a molecular weight of 190.29 g/mol, XLogP of 3.23, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzylhexan-2-one is sourced from PubChem (CID 12816361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).