About CID 163877038
CID 163877038 (PubChem CID 163877038) has the molecular formula C11H13OSe
and a molecular weight of 240.18 g/mol.
Molecular Properties
| Compound Name | CID 163877038 |
| PubChem CID | 163877038 |
| Molecular Formula | C11H13OSe |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | — |
| SMILES | CCC(Cc1ccccc1)C(=O)[Se] |
| InChI | InChI=1S/C11H13OSe/c1-2-10(11(12)13)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3 |
| InChIKey | ZRMKCJPSTVSWHX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163877038 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163877038?
The IUPAC name of CID 163877038 (CID 163877038) is not available.
What is the SMILES notation for CID 163877038?
The canonical SMILES for CID 163877038 is CCC(Cc1ccccc1)C(=O)[Se].
What is the InChIKey of CID 163877038?
The InChIKey is ZRMKCJPSTVSWHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13OSe/c1-2-10(11(12)13)8-9-6-4-3-5-7-9/h3-7,10H,2,8H2,1H3.
What are the key properties of CID 163877038?
CID 163877038 has a molecular weight of 240.18 g/mol, XLogP of 1.95, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163877038 is sourced from PubChem (CID 163877038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).