(2R)-2-[(4-phenylphenyl)methoxy]propanoic acid

C16H16O3 — CID 104875216

IUPAC(2R)-2-[(4-phenylphenyl)methoxy]propanoic acid
SMILESC[C@@H](OCc1ccc(-c2ccccc2)cc1)C(=O)O
InChIInChI=1S/C16H16O3/c1-12(16(17)18)19-11-13-7-9-15(10-8-13)14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,17,18)/t12-/m1/s1
InChIKeyUVFBEBYKZDMREB-GFCCVEGCSA-N
MW256.30 g/mol
LogP3.34
Rot. Bonds5

About (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid

(2R)-2-[(4-phenylphenyl)methoxy]propanoic acid (PubChem CID 104875216) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid.

Molecular Properties

Compound Name(2R)-2-[(4-phenylphenyl)methoxy]propanoic acid
PubChem CID104875216
Molecular FormulaC16H16O3
Molecular Weight256.30 g/mol
Exact Mass256.11
IUPAC Name(2R)-2-[(4-phenylphenyl)methoxy]propanoic acid
SMILESC[C@@H](OCc1ccc(-c2ccccc2)cc1)C(=O)O
InChIInChI=1S/C16H16O3/c1-12(16(17)18)19-11-13-7-9-15(10-8-13)14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,17,18)/t12-/m1/s1
InChIKeyUVFBEBYKZDMREB-GFCCVEGCSA-N
XLogP3.34
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.30
LogP ≤ 53.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

ethyl 2-[(4-phenylphenyl)methoxy]propanoate
CID 58354424
ethane;(2S)-2-[2-[(2S)-2-[2-(2-phenylmethoxypropanoyloxy)propanoyloxy]propanoyl]oxypropanoyloxy]propanoic acid
CID 143088943
(2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid
CID 104875246
potassium 2-phenylmethoxypropanoylazanide
CID 143775552
(2S)-2-[[(2S)-2-phenylmethoxypropanoyl]amino]propanoic acid
CID 10777126
2-[(3-bromophenyl)methoxy]propanoic acid
CID 82828681
(2S)-2-[(3-bromophenyl)methoxy]propanoic acid
CID 104875834
2-[(2-chlorophenyl)methoxy]propanoic acid
CID 24699510
phenyl 2-phenylmethoxypropanoate
CID 15731819
4-methyl-2-(2-phenylmethoxypropanoylamino)pentanoic acid
CID 43353337
(2S)-2-(2,3-dihydro-1H-inden-5-ylmethoxy)propanoic acid
CID 104876281
2-[(4-bromophenyl)methoxy]-1-phenylpropan-1-one
CID 82826900

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid?
The IUPAC name of (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid (CID 104875216) is (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid.
What is the SMILES notation for (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid?
The canonical SMILES for (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid is C[C@@H](OCc1ccc(-c2ccccc2)cc1)C(=O)O.
What is the InChIKey of (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid?
The InChIKey is UVFBEBYKZDMREB-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H16O3/c1-12(16(17)18)19-11-13-7-9-15(10-8-13)14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,17,18)/t12-/m1/s1.
What are the key properties of (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid?
(2R)-2-[(4-phenylphenyl)methoxy]propanoic acid has a molecular weight of 256.30 g/mol, XLogP of 3.34, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(4-phenylphenyl)methoxy]propanoic acid is sourced from PubChem (CID 104875216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).