(2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid

C10H12O4 — CID 104875246

IUPAC(2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid
SMILESC[C@@H](OCc1cccc(O)c1)C(=O)O
InChIInChI=1S/C10H12O4/c1-7(10(12)13)14-6-8-3-2-4-9(11)5-8/h2-5,7,11H,6H2,1H3,(H,12,13)/t7-/m1/s1
InChIKeyHTYOPQOROBPBQJ-SSDOTTSWSA-N
MW196.20 g/mol
LogP1.38
Rot. Bonds4

About (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid

(2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid (PubChem CID 104875246) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid.

Molecular Properties

Compound Name(2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid
PubChem CID104875246
Molecular FormulaC10H12O4
Molecular Weight196.20 g/mol
Exact Mass196.07
IUPAC Name(2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid
SMILESC[C@@H](OCc1cccc(O)c1)C(=O)O
InChIInChI=1S/C10H12O4/c1-7(10(12)13)14-6-8-3-2-4-9(11)5-8/h2-5,7,11H,6H2,1H3,(H,12,13)/t7-/m1/s1
InChIKeyHTYOPQOROBPBQJ-SSDOTTSWSA-N
XLogP1.38
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.20
LogP ≤ 51.38
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[(3-bromophenyl)methoxy]propanoic acid
CID 82828681
(2S)-2-[(3-bromophenyl)methoxy]propanoic acid
CID 104875834
(2R)-2-[(4-phenylphenyl)methoxy]propanoic acid
CID 104875216
(2R)-2-[(3-hydroxyphenyl)methyl]-3-methylbutanoic acid
CID 90059046
(2S)-2-(2,3-dihydro-1H-inden-5-ylmethoxy)propanoic acid
CID 104876281
ethane;(2S)-2-[2-[(2S)-2-[2-(2-phenylmethoxypropanoyloxy)propanoyloxy]propanoyl]oxypropanoyloxy]propanoic acid
CID 143088943
2-[(3-methoxyphenyl)methoxy]-1-phenylpropan-1-one
CID 62030765
potassium 2-phenylmethoxypropanoylazanide
CID 143775552
(2S)-2-(naphthalen-1-ylmethoxy)propanoic acid
CID 104876043
(2S)-2-[(5-bromothiophen-3-yl)methoxy]propanoic acid
CID 104876000
ethyl 2-[(3-bromophenyl)methoxy]propanoate
CID 82827861
N-[(3-hydroxyphenyl)methyl]-2-propan-2-yloxyacetamide
CID 112686889

Frequently Asked Questions

What is the IUPAC name of (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid?
The IUPAC name of (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid (CID 104875246) is (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid.
What is the SMILES notation for (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid?
The canonical SMILES for (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid is C[C@@H](OCc1cccc(O)c1)C(=O)O.
What is the InChIKey of (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid?
The InChIKey is HTYOPQOROBPBQJ-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H12O4/c1-7(10(12)13)14-6-8-3-2-4-9(11)5-8/h2-5,7,11H,6H2,1H3,(H,12,13)/t7-/m1/s1.
What are the key properties of (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid?
(2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid has a molecular weight of 196.20 g/mol, XLogP of 1.38, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(3-hydroxyphenyl)methoxy]propanoic acid is sourced from PubChem (CID 104875246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).